C21H26ClN2O+ — CID 162831005
[17-(chloromethyl)-15-ethylidene-3-methyl-3-aza-17-azoniapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4,6,8-tetraen-13-yl]methanol (PubChem CID 162831005) has the molecular formula C21H26ClN2O+ and a molecular weight of 357.91 g/mol. Its IUPAC name is [17-(chloromethyl)-15-ethylidene-3-methyl-3-aza-17-azoniapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4,6,8-tetraen-13-yl]methanol.
| Compound Name | [17-(chloromethyl)-15-ethylidene-3-methyl-3-aza-17-azoniapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4,6,8-tetraen-13-yl]methanol |
|---|---|
| PubChem CID | 162831005 |
| Molecular Formula | C21H26ClN2O+ |
| Molecular Weight | 357.91 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | [17-(chloromethyl)-15-ethylidene-3-methyl-3-aza-17-azoniapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4,6,8-tetraen-13-yl]methanol |
| SMILES | CC=C1C[N+]2(CCl)C3CC1C(CO)C2Cc1c3n(C)c2ccccc12 |
| InChI | InChI=1S/C21H26ClN2O/c1-3-13-10-24(12-22)19-9-16-14-6-4-5-7-18(14)23(2)21(16)20(24)8-15(13)17(19)11-25/h3-7,15,17,19-20,25H,8-12H2,1-2H3/q+1 |
| InChIKey | UIEKHYIYGGOXQK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.91 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|