C77H104N4O9 — CID 162831674
CID 162831674 (PubChem CID 162831674) has the molecular formula C77H104N4O9 and a molecular weight of 1229.70 g/mol.
| Compound Name | CID 162831674 |
|---|---|
| PubChem CID | 162831674 |
| Molecular Formula | C77H104N4O9 |
| Molecular Weight | 1229.70 g/mol |
| Exact Mass | 1228.78 |
| IUPAC Name | — |
| SMILES | CC[C@@H]1CC[C@@H]2[C@H](C1)[C@H]1/C=C/C(=O)[C@@]3(Cc4ccc(O)c(OC)c4)CCC[C@H]3CC#CN=C(NC3CCCCC3)Nc3cc(cc4c3OC#CC3(CCCCC3)[C@@H]3C[C@](CNC)(C[C@@]35C=C[C@@H]3C[C@H]6CC[C@H](CO)[C@H]6O[C@@]3(O)C5)O4)[C@]13CCC[C@H]3[C@H]2CCCO |
| InChI | InChI=1S/C77H104N4O9/c1-4-50-21-25-58-59(19-14-37-82)61-20-12-33-76(61)56-42-63(81-71(80-57-17-7-5-8-18-57)79-36-13-16-54-15-11-32-75(54,68(85)28-26-62(76)60(58)39-50)44-51-22-27-64(84)65(40-51)87-3)70-66(43-56)89-74(49-78-2)45-67(72(35-38-88-70)30-9-6-10-31-72)73(47-74)34-29-55-41-52-23-24-53(46-83)69(52)90-77(55,86)48-73/h22,26-29,34,40,42-43,50,52-55,57-62,67,69,78,82-84,86H,4-12,14-21,23-25,30-33,37,39,41,44-49H2,1-3H3,(H2,79,80,81)/b28-26+/t50-,52-,53-,54+,55-,58+,59+,60+,61+,62-,67+,69+,73-,74-,75-,76+,77+/m1/s1 |
| InChIKey | SVOLYKTXHXKXLD-HXXGDIMBSA-N |
| XLogP | 13.22 |
| TPSA | 183.36 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 90 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1229.70 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|