C75H100N4O9 — CID 163099744
CID 163099744 (PubChem CID 163099744) has the molecular formula C75H100N4O9 and a molecular weight of 1201.64 g/mol.
| Compound Name | CID 163099744 |
|---|---|
| PubChem CID | 163099744 |
| Molecular Formula | C75H100N4O9 |
| Molecular Weight | 1201.64 g/mol |
| Exact Mass | 1200.75 |
| IUPAC Name | — |
| SMILES | CCC1CCC2C(C1)C1C=CC(=O)C3(Cc4ccc(O)c(OC)c4)CCCC3CC#CN/C(=N\C)Nc3cc(cc4c3OC#CCC3CC(CNC)(CC35C=CC3CC6CCC(CO)C6OC3(O)C5)O4)C13CCC1(CCC4(CCCC4)C1)C3C2CCCO |
| InChI | InChI=1S/C75H100N4O9/c1-5-48-16-20-56-57(15-10-34-80)67-70(30-29-69(44-70)25-6-7-26-69)31-32-74(67)55-39-60(79-68(77-3)78-33-9-13-52-12-8-27-73(52,64(83)23-21-59(74)58(56)36-48)41-49-17-22-61(82)62(37-49)85-4)66-63(40-55)87-72(47-76-2)42-54(14-11-35-86-66)71(45-72)28-24-53-38-50-18-19-51(43-81)65(50)88-75(53,84)46-71/h17,21-24,28,37,39-40,48,50-54,56-59,65,67,76,80-82,84H,5-8,10,12-16,18-20,25-27,29-32,34,36,38,41-47H2,1-4H3,(H2,77,78,79) |
| InChIKey | VVBDAYYQNPVYSH-UHFFFAOYSA-N |
| XLogP | 12.30 |
| TPSA | 183.36 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 88 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1201.64 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|