C74H103N3O14S2 — CID 162838047
CID 162838047 (PubChem CID 162838047) has the molecular formula C74H103N3O14S2 and a molecular weight of 1322.78 g/mol.
| Compound Name | CID 162838047 |
|---|---|
| PubChem CID | 162838047 |
| Molecular Formula | C74H103N3O14S2 |
| Molecular Weight | 1322.78 g/mol |
| Exact Mass | 1321.69 |
| IUPAC Name | — |
| SMILES | COc1cc(C[C@@H]2[C@H](O)CSS[C@H]3C[C@@H](O)c4cccc5cn(cc45)COCCC[C@H]4NC(=O)C5(CCCCC5)[C@@H]4[C@@H](O)CC[C@@H]4CC[C@@H](C)C[C@@]45C#CCC4(CCCCC4)NC[C@H]4CC[C@H](C[C@@H]45)Oc4cc(c3cc4O)CC[C@H](OCO)C[C@H]2O)cc(OCO)c1O |
| InChI | InChI=1S/C74H103N3O14S2/c1-46-15-18-51-19-22-60(80)69-59(76-71(86)73(69)26-7-4-8-27-73)14-10-29-88-43-77-40-50-12-9-13-54(57(50)41-77)62(82)37-68-55-36-63(83)65(91-53-21-17-49-39-75-72(23-5-3-6-24-72)25-11-28-74(51,38-46)58(49)34-53)33-48(55)16-20-52(89-44-78)35-61(81)56(64(84)42-92-93-68)30-47-31-66(87-2)70(85)67(32-47)90-45-79/h9,12-13,31-33,36,40-41,46,49,51-53,56,58-62,64,68-69,75,78-85H,3-8,10,14-27,29-30,34-35,37-39,42-45H2,1-2H3,(H,76,86)/t46-,49-,51+,52+,53-,56+,58+,59-,60+,61-,62-,64-,68+,69+,74+/m1/s1 |
| InChIKey | GBNOKIJOQMKNCK-BYHWFJNRSA-N |
| XLogP | 11.45 |
| TPSA | 254.05 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 93 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1322.78 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|