C57H84N2O12S2 — CID 162867477
CID 162867477 (PubChem CID 162867477) has the molecular formula C57H84N2O12S2 and a molecular weight of 1053.43 g/mol.
| Compound Name | CID 162867477 |
|---|---|
| PubChem CID | 162867477 |
| Molecular Formula | C57H84N2O12S2 |
| Molecular Weight | 1053.43 g/mol |
| Exact Mass | 1052.55 |
| IUPAC Name | — |
| SMILES | COc1cc(C[C@H]2[C@H](O)C[C@@H](OCO)CCc3cc(O[C@@H]4CC[C@H]5CNC6(CC#C[C@]7(C[C@@H](C)CC[C@H]7CC[C@H](O)[C@H]7CNC(=O)C7)[C@H]5C4)CCCCC6)c(O)cc3[C@H](CCO)SSC[C@@H]2O)cc(OC)c1O |
| InChI | InChI=1S/C57H84N2O12S2/c1-35-8-11-40(12-15-46(62)39-26-54(66)58-31-39)57(30-35)20-7-19-56(17-5-4-6-18-56)59-32-38-10-14-42(27-45(38)57)71-50-25-37-9-13-41(70-34-61)28-47(63)44(22-36-23-51(68-2)55(67)52(24-36)69-3)49(65)33-72-73-53(16-21-60)43(37)29-48(50)64/h23-25,29,35,38-42,44-47,49,53,59-65,67H,4-6,8-19,21-22,26-28,30-34H2,1-3H3,(H,58,66)/t35-,38-,39+,40-,41-,42+,44-,45-,46-,47+,49-,53-,57+/m0/s1 |
| InChIKey | CQNJPAFGJOSWBA-YBQVWFIESA-N |
| XLogP | 7.74 |
| TPSA | 219.66 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 73 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1053.43 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|