C29H37NO5 — CID 162839505
1-[(1S,4S,5S,7R)-7-hydroxy-5-(hydroxymethyl)-7-methoxy-2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl]-3-[3-[3-hydroxy-5-(methylaminomethyl)phenyl]phenyl]propan-1-one (PubChem CID 162839505) has the molecular formula C29H37NO5 and a molecular weight of 479.62 g/mol. Its IUPAC name is 1-[(1S,4S,5S,7R)-7-hydroxy-5-(hydroxymethyl)-7-methoxy-2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl]-3-[3-[3-hydroxy-5-(methylaminomethyl)phenyl]phenyl]propan-1-one.
| Compound Name | 1-[(1S,4S,5S,7R)-7-hydroxy-5-(hydroxymethyl)-7-methoxy-2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl]-3-[3-[3-hydroxy-5-(methylaminomethyl)phenyl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 162839505 |
| Molecular Formula | C29H37NO5 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | 1-[(1S,4S,5S,7R)-7-hydroxy-5-(hydroxymethyl)-7-methoxy-2,2-dimethyl-3-methylidene-1-bicyclo[2.2.1]heptanyl]-3-[3-[3-hydroxy-5-(methylaminomethyl)phenyl]phenyl]propan-1-one |
| SMILES | C=C1[C@@H]2[C@@H](CO)C[C@@](C(=O)CCc3cccc(-c4cc(O)cc(CNC)c4)c3)(C1(C)C)[C@]2(O)OC |
| InChI | InChI=1S/C29H37NO5/c1-18-26-23(17-31)15-28(27(18,2)3,29(26,34)35-5)25(33)10-9-19-7-6-8-21(11-19)22-12-20(16-30-4)13-24(32)14-22/h6-8,11-14,23,26,30-32,34H,1,9-10,15-17H2,2-5H3/t23-,26-,28-,29-/m1/s1 |
| InChIKey | WDIQUFNVAMXTCV-XRMDXACKSA-N |
| XLogP | 3.83 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|