C23H24N6O3S — CID 162839722
(3aR,4R,5R,7S,7aR)-4,5-dihydroxy-2-(4-pyrazol-1-ylanilino)-N-(pyridin-3-ylmethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 162839722) has the molecular formula C23H24N6O3S and a molecular weight of 464.55 g/mol. Its IUPAC name is (3aR,4R,5R,7S,7aR)-4,5-dihydroxy-2-(4-pyrazol-1-ylanilino)-N-(pyridin-3-ylmethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | (3aR,4R,5R,7S,7aR)-4,5-dihydroxy-2-(4-pyrazol-1-ylanilino)-N-(pyridin-3-ylmethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 162839722 |
| Molecular Formula | C23H24N6O3S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | (3aR,4R,5R,7S,7aR)-4,5-dihydroxy-2-(4-pyrazol-1-ylanilino)-N-(pyridin-3-ylmethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | O=C(NCc1cccnc1)[C@@H]1C[C@@H](O)[C@H](O)[C@H]2N=C(Nc3ccc(-n4cccn4)cc3)S[C@@H]21 |
| InChI | InChI=1S/C23H24N6O3S/c30-18-11-17(22(32)25-13-14-3-1-8-24-12-14)21-19(20(18)31)28-23(33-21)27-15-4-6-16(7-5-15)29-10-2-9-26-29/h1-10,12,17-21,30-31H,11,13H2,(H,25,32)(H,27,28)/t17-,18-,19-,20+,21-/m1/s1 |
| InChIKey | RHKGGTIXGYLPOU-SSSFQFABSA-N |
| XLogP | 1.58 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |