C20H20N6O3S2 — CID 40780799
(3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-(4-pyrazol-1-ylanilino)-N-(1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 40780799) has the molecular formula C20H20N6O3S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is (3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-(4-pyrazol-1-ylanilino)-N-(1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | (3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-(4-pyrazol-1-ylanilino)-N-(1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 40780799 |
| Molecular Formula | C20H20N6O3S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | (3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-(4-pyrazol-1-ylanilino)-N-(1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | O=C(Nc1nccs1)[C@H]1C[C@@H](O)[C@H](O)[C@@H]2N=C(Nc3ccc(-n4cccn4)cc3)S[C@@H]21 |
| InChI | InChI=1S/C20H20N6O3S2/c27-14-10-13(18(29)25-19-21-7-9-30-19)17-15(16(14)28)24-20(31-17)23-11-2-4-12(5-3-11)26-8-1-6-22-26/h1-9,13-17,27-28H,10H2,(H,23,24)(H,21,25,29)/t13-,14+,15-,16-,17+/m0/s1 |
| InChIKey | PHEAKGURYJLNRK-BQJWPVKWSA-N |
| XLogP | 1.96 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |