C19H23N5O3S2 — CID 163138959
(3aR,4R,5R,7R,7aR)-2-[4-(dimethylamino)anilino]-4,5-dihydroxy-N-(1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 163138959) has the molecular formula C19H23N5O3S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is (3aR,4R,5R,7R,7aR)-2-[4-(dimethylamino)anilino]-4,5-dihydroxy-N-(1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | (3aR,4R,5R,7R,7aR)-2-[4-(dimethylamino)anilino]-4,5-dihydroxy-N-(1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 163138959 |
| Molecular Formula | C19H23N5O3S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | (3aR,4R,5R,7R,7aR)-2-[4-(dimethylamino)anilino]-4,5-dihydroxy-N-(1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | CN(C)c1ccc(NC2=N[C@@H]3[C@@H](O)[C@H](O)C[C@H](C(=O)Nc4nccs4)[C@H]3S2)cc1 |
| InChI | InChI=1S/C19H23N5O3S2/c1-24(2)11-5-3-10(4-6-11)21-19-22-14-15(26)13(25)9-12(16(14)29-19)17(27)23-18-20-7-8-28-18/h3-8,12-16,25-26H,9H2,1-2H3,(H,21,22)(H,20,23,27)/t12-,13+,14+,15-,16+/m0/s1 |
| InChIKey | JAXUXMZUJVDUAB-CQJMVSDSSA-N |
| XLogP | 1.84 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|