C18H20N4O4S2 — CID 11940072
(3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-(4-methoxyanilino)-N-(1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 11940072) has the molecular formula C18H20N4O4S2 and a molecular weight of 420.52 g/mol. Its IUPAC name is (3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-(4-methoxyanilino)-N-(1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | (3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-(4-methoxyanilino)-N-(1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 11940072 |
| Molecular Formula | C18H20N4O4S2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | (3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-(4-methoxyanilino)-N-(1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | COc1ccc(NC2=N[C@H]3[C@@H](O)[C@H](O)C[C@H](C(=O)Nc4nccs4)[C@H]3S2)cc1 |
| InChI | InChI=1S/C18H20N4O4S2/c1-26-10-4-2-9(3-5-10)20-18-21-13-14(24)12(23)8-11(15(13)28-18)16(25)22-17-19-6-7-27-17/h2-7,11-15,23-24H,8H2,1H3,(H,20,21)(H,19,22,25)/t11-,12+,13-,14-,15+/m0/s1 |
| InChIKey | BLZIFRDGVNKBDP-AIEDFZFUSA-N |
| XLogP | 1.78 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |