C18H18N4O5S2 — CID 40780797
(3aS,4R,5R,7R,7aR)-2-(1,3-benzodioxol-5-ylamino)-4,5-dihydroxy-N-(1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 40780797) has the molecular formula C18H18N4O5S2 and a molecular weight of 434.50 g/mol. Its IUPAC name is (3aS,4R,5R,7R,7aR)-2-(1,3-benzodioxol-5-ylamino)-4,5-dihydroxy-N-(1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | (3aS,4R,5R,7R,7aR)-2-(1,3-benzodioxol-5-ylamino)-4,5-dihydroxy-N-(1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 40780797 |
| Molecular Formula | C18H18N4O5S2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | (3aS,4R,5R,7R,7aR)-2-(1,3-benzodioxol-5-ylamino)-4,5-dihydroxy-N-(1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | O=C(Nc1nccs1)[C@H]1C[C@@H](O)[C@H](O)[C@@H]2N=C(Nc3ccc4c(c3)OCO4)S[C@@H]21 |
| InChI | InChI=1S/C18H18N4O5S2/c23-10-6-9(16(25)22-17-19-3-4-28-17)15-13(14(10)24)21-18(29-15)20-8-1-2-11-12(5-8)27-7-26-11/h1-5,9-10,13-15,23-24H,6-7H2,(H,20,21)(H,19,22,25)/t9-,10+,13-,14-,15+/m0/s1 |
| InChIKey | AAMPCCBFFSRZFO-GHBALNIRSA-N |
| XLogP | 1.50 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |