C35H34O5 — CID 162842193
1-[2,4-dihydroxy-3-(5-hydroxy-1,7-diphenylhept-2-enyl)-6-methoxyphenyl]-3-phenylprop-2-en-1-one (PubChem CID 162842193) has the molecular formula C35H34O5 and a molecular weight of 534.65 g/mol. Its IUPAC name is 1-[2,4-dihydroxy-3-(5-hydroxy-1,7-diphenylhept-2-enyl)-6-methoxyphenyl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[2,4-dihydroxy-3-(5-hydroxy-1,7-diphenylhept-2-enyl)-6-methoxyphenyl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 162842193 |
| Molecular Formula | C35H34O5 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | 1-[2,4-dihydroxy-3-(5-hydroxy-1,7-diphenylhept-2-enyl)-6-methoxyphenyl]-3-phenylprop-2-en-1-one |
| SMILES | COc1cc(O)c(C(C=CCC(O)CCc2ccccc2)c2ccccc2)c(O)c1C(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C35H34O5/c1-40-32-24-31(38)33(35(39)34(32)30(37)23-21-26-14-7-3-8-15-26)29(27-16-9-4-10-17-27)19-11-18-28(36)22-20-25-12-5-2-6-13-25/h2-17,19,21,23-24,28-29,36,38-39H,18,20,22H2,1H3 |
| InChIKey | ZGDVGQZBBLIRKQ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|