C35H34O7 — CID 56601078
(E)-1-[2,4-dihydroxy-3-[(E,1R,5R)-5-hydroxy-1,7-bis(4-hydroxyphenyl)hept-2-enyl]-6-methoxyphenyl]-3-phenylprop-2-en-1-one (PubChem CID 56601078) has the molecular formula C35H34O7 and a molecular weight of 566.65 g/mol. Its IUPAC name is (E)-1-[2,4-dihydroxy-3-[(E,1R,5R)-5-hydroxy-1,7-bis(4-hydroxyphenyl)hept-2-enyl]-6-methoxyphenyl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[2,4-dihydroxy-3-[(E,1R,5R)-5-hydroxy-1,7-bis(4-hydroxyphenyl)hept-2-enyl]-6-methoxyphenyl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 56601078 |
| Molecular Formula | C35H34O7 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | (E)-1-[2,4-dihydroxy-3-[(E,1R,5R)-5-hydroxy-1,7-bis(4-hydroxyphenyl)hept-2-enyl]-6-methoxyphenyl]-3-phenylprop-2-en-1-one |
| SMILES | COc1cc(O)c([C@H](/C=C/C[C@H](O)CCc2ccc(O)cc2)c2ccc(O)cc2)c(O)c1C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C35H34O7/c1-42-32-22-31(40)33(35(41)34(32)30(39)21-13-23-6-3-2-4-7-23)29(25-14-19-28(38)20-15-25)9-5-8-26(36)16-10-24-11-17-27(37)18-12-24/h2-7,9,11-15,17-22,26,29,36-38,40-41H,8,10,16H2,1H3/b9-5+,21-13+/t26-,29+/m0/s1 |
| InChIKey | CHMHCJPJPCCBKX-CJIDPTHHSA-N |
| XLogP | 6.49 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|