C18H26O16 — CID 162842865
7-(6-carboxy-3,4,5-trihydroxyoxan-2-yl)oxy-6,13,14-trihydroxy-12-methyl-2,4,9,11-tetraoxatricyclo[8.4.0.03,8]tetradecane-5-carboxylic acid (PubChem CID 162842865) has the molecular formula C18H26O16 and a molecular weight of 498.39 g/mol. Its IUPAC name is 7-(6-carboxy-3,4,5-trihydroxyoxan-2-yl)oxy-6,13,14-trihydroxy-12-methyl-2,4,9,11-tetraoxatricyclo[8.4.0.03,8]tetradecane-5-carboxylic acid.
| Compound Name | 7-(6-carboxy-3,4,5-trihydroxyoxan-2-yl)oxy-6,13,14-trihydroxy-12-methyl-2,4,9,11-tetraoxatricyclo[8.4.0.03,8]tetradecane-5-carboxylic acid |
|---|---|
| PubChem CID | 162842865 |
| Molecular Formula | C18H26O16 |
| Molecular Weight | 498.39 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 7-(6-carboxy-3,4,5-trihydroxyoxan-2-yl)oxy-6,13,14-trihydroxy-12-methyl-2,4,9,11-tetraoxatricyclo[8.4.0.03,8]tetradecane-5-carboxylic acid |
| SMILES | CC1OC2OC3C(OC(C(=O)O)C(O)C3OC3OC(C(=O)O)C(O)C(O)C3O)OC2C(O)C1O |
| InChI | InChI=1S/C18H26O16/c1-2-3(19)5(21)12-17(29-2)34-13-9(8(24)11(15(27)28)32-18(13)33-12)30-16-7(23)4(20)6(22)10(31-16)14(25)26/h2-13,16-24H,1H3,(H,25,26)(H,27,28) |
| InChIKey | QWWWBLPKYYPPLX-UHFFFAOYSA-N |
| XLogP | -5.32 |
| TPSA | 251.36 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.39 |
| LogP ≤ 5 | -5.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |