C18H28O10 — CID 162843141
[5-hydroxy-4,7-dimethyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-7-yl] acetate (PubChem CID 162843141) has the molecular formula C18H28O10 and a molecular weight of 404.41 g/mol. Its IUPAC name is [5-hydroxy-4,7-dimethyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-7-yl] acetate.
| Compound Name | [5-hydroxy-4,7-dimethyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-7-yl] acetate |
|---|---|
| PubChem CID | 162843141 |
| Molecular Formula | C18H28O10 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [5-hydroxy-4,7-dimethyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-7-yl] acetate |
| SMILES | CC(=O)OC1(C)CC(O)C2C(C)=COC(OC3OC(CO)C(O)C(O)C3O)C21 |
| InChI | InChI=1S/C18H28O10/c1-7-6-25-16(12-11(7)9(21)4-18(12,3)28-8(2)20)27-17-15(24)14(23)13(22)10(5-19)26-17/h6,9-17,19,21-24H,4-5H2,1-3H3 |
| InChIKey | IXJKAIYQDPLVQL-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |