C17H26O9 — CID 75148164
[7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-7-yl] acetate (PubChem CID 75148164) has the molecular formula C17H26O9 and a molecular weight of 374.39 g/mol. Its IUPAC name is [7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-7-yl] acetate.
| Compound Name | [7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-7-yl] acetate |
|---|---|
| PubChem CID | 75148164 |
| Molecular Formula | C17H26O9 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-7-yl] acetate |
| SMILES | CC(=O)OC1(C)CCC2C=COC(OC3OC(CO)C(O)C(O)C3O)C21 |
| InChI | InChI=1S/C17H26O9/c1-8(19)26-17(2)5-3-9-4-6-23-15(11(9)17)25-16-14(22)13(21)12(20)10(7-18)24-16/h4,6,9-16,18,20-22H,3,5,7H2,1-2H3 |
| InChIKey | VCXAJOGTIREAPX-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |