C38H69NO12S — CID 162844378
2-[[(4R,6R,7S,9R)-9-[(9S,10E,17R,18E)-9-acetyloxy-17-hydroxytetracosa-10,18-dienoyl]oxy-4,6,7-trihydroxydecanoyl]amino]ethanesulfonic acid (PubChem CID 162844378) has the molecular formula C38H69NO12S and a molecular weight of 764.03 g/mol. Its IUPAC name is 2-[[(4R,6R,7S,9R)-9-[(9S,10E,17R,18E)-9-acetyloxy-17-hydroxytetracosa-10,18-dienoyl]oxy-4,6,7-trihydroxydecanoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[(4R,6R,7S,9R)-9-[(9S,10E,17R,18E)-9-acetyloxy-17-hydroxytetracosa-10,18-dienoyl]oxy-4,6,7-trihydroxydecanoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 162844378 |
| Molecular Formula | C38H69NO12S |
| Molecular Weight | 764.03 g/mol |
| Exact Mass | 763.45 |
| IUPAC Name | 2-[[(4R,6R,7S,9R)-9-[(9S,10E,17R,18E)-9-acetyloxy-17-hydroxytetracosa-10,18-dienoyl]oxy-4,6,7-trihydroxydecanoyl]amino]ethanesulfonic acid |
| SMILES | CCCCC/C=C/[C@H](O)CCCCC/C=C/[C@H](CCCCCCCC(=O)O[C@H](C)C[C@H](O)[C@H](O)C[C@H](O)CCC(=O)NCCS(=O)(=O)O)OC(C)=O |
| InChI | InChI=1S/C38H69NO12S/c1-4-5-6-9-14-19-32(41)20-15-10-7-11-16-21-34(51-31(3)40)22-17-12-8-13-18-23-38(46)50-30(2)28-35(43)36(44)29-33(42)24-25-37(45)39-26-27-52(47,48)49/h14,16,19,21,30,32-36,41-44H,4-13,15,17-18,20,22-29H2,1-3H3,(H,39,45)(H,47,48,49)/b19-14+,21-16+/t30-,32+,33-,34-,35+,36-/m1/s1 |
| InChIKey | YKCSKYFYYUFOQO-WWAPFYRDSA-N |
| XLogP | 5.23 |
| TPSA | 216.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 52 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.03 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|