C20H35NO4S — CID 171117146
2-[[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]amino]ethanesulfonic acid (PubChem CID 171117146) has the molecular formula C20H35NO4S and a molecular weight of 385.57 g/mol. Its IUPAC name is 2-[[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 171117146 |
| Molecular Formula | C20H35NO4S |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 2-[[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]amino]ethanesulfonic acid |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C20H35NO4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)21-18-19-26(23,24)25/h6-7,9-10,12-13H,2-5,8,11,14-19H2,1H3,(H,21,22)(H,23,24,25)/b7-6-,10-9-,13-12- |
| InChIKey | MWTKTHSMKWCXQZ-QNEBEIHSSA-N |
| XLogP | 4.58 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|