C21H42N2O4S — CID 175166237
2-[[[(Z)-octadec-9-enoyl]amino]methylamino]ethanesulfonic acid (PubChem CID 175166237) has the molecular formula C21H42N2O4S and a molecular weight of 418.64 g/mol. Its IUPAC name is 2-[[[(Z)-octadec-9-enoyl]amino]methylamino]ethanesulfonic acid.
| Compound Name | 2-[[[(Z)-octadec-9-enoyl]amino]methylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 175166237 |
| Molecular Formula | C21H42N2O4S |
| Molecular Weight | 418.64 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | 2-[[[(Z)-octadec-9-enoyl]amino]methylamino]ethanesulfonic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCNCCS(=O)(=O)O |
| InChI | InChI=1S/C21H42N2O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)23-20-22-18-19-28(25,26)27/h9-10,22H,2-8,11-20H2,1H3,(H,23,24)(H,25,26,27)/b10-9- |
| InChIKey | PXVNHVDIBRFDBX-KTKRTIGZSA-N |
| XLogP | 4.57 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.64 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|