C16H24O5 — CID 162845835
methyl (2R)-2-[(1R,2R,4aS,8S,8aR)-1,8-dihydroxy-4a,8-dimethyl-5-oxo-2,3,4,8a-tetrahydro-1H-naphthalen-2-yl]propanoate (PubChem CID 162845835) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is methyl (2R)-2-[(1R,2R,4aS,8S,8aR)-1,8-dihydroxy-4a,8-dimethyl-5-oxo-2,3,4,8a-tetrahydro-1H-naphthalen-2-yl]propanoate.
| Compound Name | methyl (2R)-2-[(1R,2R,4aS,8S,8aR)-1,8-dihydroxy-4a,8-dimethyl-5-oxo-2,3,4,8a-tetrahydro-1H-naphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 162845835 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | methyl (2R)-2-[(1R,2R,4aS,8S,8aR)-1,8-dihydroxy-4a,8-dimethyl-5-oxo-2,3,4,8a-tetrahydro-1H-naphthalen-2-yl]propanoate |
| SMILES | COC(=O)[C@H](C)[C@H]1CC[C@]2(C)C(=O)C=C[C@](C)(O)[C@H]2[C@@H]1O |
| InChI | InChI=1S/C16H24O5/c1-9(14(19)21-4)10-5-7-15(2)11(17)6-8-16(3,20)13(15)12(10)18/h6,8-10,12-13,18,20H,5,7H2,1-4H3/t9-,10-,12-,13+,15-,16+/m1/s1 |
| InChIKey | QTWFZVHPPOTAGN-LXYWZBBSSA-N |
| XLogP | 1.08 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |