C27H42N2O4 — CID 162846719
[4-(5-methoxy-3-methyl-5-oxopent-3-enyl)-3,4,8,8a-tetramethyl-1,2,3,4a,5,6-hexahydronaphthalen-1-yl] 4,5-dimethyl-3,4-dihydropyrazole-5-carboxylate (PubChem CID 162846719) has the molecular formula C27H42N2O4 and a molecular weight of 458.64 g/mol. Its IUPAC name is [4-(5-methoxy-3-methyl-5-oxopent-3-enyl)-3,4,8,8a-tetramethyl-1,2,3,4a,5,6-hexahydronaphthalen-1-yl] 4,5-dimethyl-3,4-dihydropyrazole-5-carboxylate.
| Compound Name | [4-(5-methoxy-3-methyl-5-oxopent-3-enyl)-3,4,8,8a-tetramethyl-1,2,3,4a,5,6-hexahydronaphthalen-1-yl] 4,5-dimethyl-3,4-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 162846719 |
| Molecular Formula | C27H42N2O4 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | [4-(5-methoxy-3-methyl-5-oxopent-3-enyl)-3,4,8,8a-tetramethyl-1,2,3,4a,5,6-hexahydronaphthalen-1-yl] 4,5-dimethyl-3,4-dihydropyrazole-5-carboxylate |
| SMILES | COC(=O)C=C(C)CCC1(C)C(C)CC(OC(=O)C2(C)N=NCC2C)C2(C)C(C)=CCCC12 |
| InChI | InChI=1S/C27H42N2O4/c1-17(14-23(30)32-8)12-13-25(5)19(3)15-22(26(6)18(2)10-9-11-21(25)26)33-24(31)27(7)20(4)16-28-29-27/h10,14,19-22H,9,11-13,15-16H2,1-8H3 |
| InChIKey | KCVCQNTUDNRSLY-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|