C31H44O7 — CID 177437742
[(4aR,5R,7R,8S,8aR)-5-hydroxy-8-[(Z)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-4,7,8-trimethyl-1,2,5,6,7,8a-hexahydronaphthalen-4a-yl]methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 177437742) has the molecular formula C31H44O7 and a molecular weight of 528.69 g/mol. Its IUPAC name is [(4aR,5R,7R,8S,8aR)-5-hydroxy-8-[(Z)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-4,7,8-trimethyl-1,2,5,6,7,8a-hexahydronaphthalen-4a-yl]methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [(4aR,5R,7R,8S,8aR)-5-hydroxy-8-[(Z)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-4,7,8-trimethyl-1,2,5,6,7,8a-hexahydronaphthalen-4a-yl]methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 177437742 |
| Molecular Formula | C31H44O7 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | [(4aR,5R,7R,8S,8aR)-5-hydroxy-8-[(Z)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-4,7,8-trimethyl-1,2,5,6,7,8a-hexahydronaphthalen-4a-yl]methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OC[C@]23C(C)=CCC[C@@H]2[C@@](C)(CC/C(=C/CO)CO)[C@H](C)C[C@H]3O)cc1OC |
| InChI | InChI=1S/C31H44O7/c1-21-7-6-8-27-30(3,15-13-24(19-33)14-16-32)22(2)17-28(34)31(21,27)20-38-29(35)12-10-23-9-11-25(36-4)26(18-23)37-5/h7,9-12,14,18,22,27-28,32-34H,6,8,13,15-17,19-20H2,1-5H3/b12-10+,24-14-/t22-,27-,28-,30+,31+/m1/s1 |
| InChIKey | IYDYTWMZYUGYNO-QRRNJFOLSA-N |
| XLogP | 4.70 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|