C21H32O4 — CID 162847328
[7-(1-methoxy-1-oxopropan-2-yl)-4a-methyl-1-methylidene-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] 2-methylbut-2-enoate (PubChem CID 162847328) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is [7-(1-methoxy-1-oxopropan-2-yl)-4a-methyl-1-methylidene-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] 2-methylbut-2-enoate.
| Compound Name | [7-(1-methoxy-1-oxopropan-2-yl)-4a-methyl-1-methylidene-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162847328 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | [7-(1-methoxy-1-oxopropan-2-yl)-4a-methyl-1-methylidene-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl] 2-methylbut-2-enoate |
| SMILES | C=C1C(OC(=O)C(C)=CC)CCC2(C)CCC(C(C)C(=O)OC)CC12 |
| InChI | InChI=1S/C21H32O4/c1-7-13(2)19(22)25-18-9-11-21(5)10-8-16(12-17(21)15(18)4)14(3)20(23)24-6/h7,14,16-18H,4,8-12H2,1-3,5-6H3 |
| InChIKey | BZWMCEKTBZKOGB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|