C20H26O5 — CID 162849453
(1R,2S,5R)-2-[(3aS,4S,7aR)-7a-methyl-1,3-dioxo-4,5,6,7-tetrahydro-3aH-2-benzofuran-4-yl]-2-methyl-6-methylidenebicyclo[3.2.1]octane-1-carboxylic acid (PubChem CID 162849453) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is (1R,2S,5R)-2-[(3aS,4S,7aR)-7a-methyl-1,3-dioxo-4,5,6,7-tetrahydro-3aH-2-benzofuran-4-yl]-2-methyl-6-methylidenebicyclo[3.2.1]octane-1-carboxylic acid.
| Compound Name | (1R,2S,5R)-2-[(3aS,4S,7aR)-7a-methyl-1,3-dioxo-4,5,6,7-tetrahydro-3aH-2-benzofuran-4-yl]-2-methyl-6-methylidenebicyclo[3.2.1]octane-1-carboxylic acid |
|---|---|
| PubChem CID | 162849453 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (1R,2S,5R)-2-[(3aS,4S,7aR)-7a-methyl-1,3-dioxo-4,5,6,7-tetrahydro-3aH-2-benzofuran-4-yl]-2-methyl-6-methylidenebicyclo[3.2.1]octane-1-carboxylic acid |
| SMILES | C=C1C[C@]2(C(=O)O)C[C@H]1CC[C@@]2(C)[C@H]1CCC[C@@]2(C)C(=O)OC(=O)[C@@H]12 |
| InChI | InChI=1S/C20H26O5/c1-11-9-20(16(22)23)10-12(11)6-8-19(20,3)13-5-4-7-18(2)14(13)15(21)25-17(18)24/h12-14H,1,4-10H2,2-3H3,(H,22,23)/t12-,13+,14-,18-,19+,20-/m1/s1 |
| InChIKey | DNDDGKFGWMYCIM-CMKQGYTDSA-N |
| XLogP | 3.33 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|