C19H24O4 — CID 163044494
12-hydroxy-13-methyl-4-methylidene-15-oxapentacyclo[7.7.1.12,5.02,8.013,17]octadecane-14,16-dione (PubChem CID 163044494) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 12-hydroxy-13-methyl-4-methylidene-15-oxapentacyclo[7.7.1.12,5.02,8.013,17]octadecane-14,16-dione.
| Compound Name | 12-hydroxy-13-methyl-4-methylidene-15-oxapentacyclo[7.7.1.12,5.02,8.013,17]octadecane-14,16-dione |
|---|---|
| PubChem CID | 163044494 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 12-hydroxy-13-methyl-4-methylidene-15-oxapentacyclo[7.7.1.12,5.02,8.013,17]octadecane-14,16-dione |
| SMILES | C=C1CC23CC1CCC2C1CCC(O)C2(C)C(=O)OC(=O)C3C12 |
| InChI | InChI=1S/C19H24O4/c1-9-7-19-8-10(9)3-5-12(19)11-4-6-13(20)18(2)14(11)15(19)16(21)23-17(18)22/h10-15,20H,1,3-8H2,2H3 |
| InChIKey | YKJVIMGPKWSYNI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|