C21H26O7 — CID 162850964
(3'-formyl-7-hydroxy-4'-methyl-10-methylidene-2,11-dioxospiro[3-oxatricyclo[7.2.1.01,6]dodecane-5,2'-cyclohexane]-1'-yl) acetate (PubChem CID 162850964) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is (3'-formyl-7-hydroxy-4'-methyl-10-methylidene-2,11-dioxospiro[3-oxatricyclo[7.2.1.01,6]dodecane-5,2'-cyclohexane]-1'-yl) acetate.
| Compound Name | (3'-formyl-7-hydroxy-4'-methyl-10-methylidene-2,11-dioxospiro[3-oxatricyclo[7.2.1.01,6]dodecane-5,2'-cyclohexane]-1'-yl) acetate |
|---|---|
| PubChem CID | 162850964 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (3'-formyl-7-hydroxy-4'-methyl-10-methylidene-2,11-dioxospiro[3-oxatricyclo[7.2.1.01,6]dodecane-5,2'-cyclohexane]-1'-yl) acetate |
| SMILES | C=C1C(=O)C23CC1CC(O)C2C1(COC3=O)C(OC(C)=O)CCC(C)C1C=O |
| InChI | InChI=1S/C21H26O7/c1-10-4-5-16(28-12(3)23)21(14(10)8-22)9-27-19(26)20-7-13(11(2)18(20)25)6-15(24)17(20)21/h8,10,13-17,24H,2,4-7,9H2,1,3H3 |
| InChIKey | YTQQITCFQLURQS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|