C20H22O7 — CID 162851332
(16-hydroxy-7-methylidene-2,8-dioxo-3,9-dioxatetracyclo[10.3.1.01,4.06,10]hexadec-11-en-5-yl) 2-methylbut-2-enoate (PubChem CID 162851332) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is (16-hydroxy-7-methylidene-2,8-dioxo-3,9-dioxatetracyclo[10.3.1.01,4.06,10]hexadec-11-en-5-yl) 2-methylbut-2-enoate.
| Compound Name | (16-hydroxy-7-methylidene-2,8-dioxo-3,9-dioxatetracyclo[10.3.1.01,4.06,10]hexadec-11-en-5-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162851332 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (16-hydroxy-7-methylidene-2,8-dioxo-3,9-dioxatetracyclo[10.3.1.01,4.06,10]hexadec-11-en-5-yl) 2-methylbut-2-enoate |
| SMILES | C=C1C(=O)OC2C=C3CCCC4(C(=O)OC4C(OC(=O)C(C)=CC)C12)C3O |
| InChI | InChI=1S/C20H22O7/c1-4-9(2)17(22)26-14-13-10(3)18(23)25-12(13)8-11-6-5-7-20(15(11)21)16(14)27-19(20)24/h4,8,12-16,21H,3,5-7H2,1-2H3 |
| InChIKey | LFAJCPGSXMKITG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|