C24H28O8 — CID 162851356
(8-acetyloxy-6-methyl-3,9-dimethylidene-2-oxo-4,6a,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl) 4-acetyloxy-2-methylbut-2-enoate (PubChem CID 162851356) has the molecular formula C24H28O8 and a molecular weight of 444.48 g/mol. Its IUPAC name is (8-acetyloxy-6-methyl-3,9-dimethylidene-2-oxo-4,6a,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl) 4-acetyloxy-2-methylbut-2-enoate.
| Compound Name | (8-acetyloxy-6-methyl-3,9-dimethylidene-2-oxo-4,6a,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl) 4-acetyloxy-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162851356 |
| Molecular Formula | C24H28O8 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | (8-acetyloxy-6-methyl-3,9-dimethylidene-2-oxo-4,6a,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl) 4-acetyloxy-2-methylbut-2-enoate |
| SMILES | C=C1C(=O)OC2C1C(OC(=O)C(C)=CCOC(C)=O)C=C(C)C1CC(OC(C)=O)C(=C)C12 |
| InChI | InChI=1S/C24H28O8/c1-11(7-8-29-15(5)25)23(27)31-19-9-12(2)17-10-18(30-16(6)26)13(3)20(17)22-21(19)14(4)24(28)32-22/h7,9,17-22H,3-4,8,10H2,1-2,5-6H3 |
| InChIKey | QQKRSWNOBSIHIS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|