C24H30O10 — CID 177431708
[(3aR,7R,10Z,11aR)-9-acetyloxy-7-hydroperoxy-10-methyl-3,6-dimethylidene-2-oxo-4,5,7,8,9,11a-hexahydro-3aH-cyclodeca[b]furan-4-yl] (E)-4-acetyloxy-2-methylbut-2-enoate (PubChem CID 177431708) has the molecular formula C24H30O10 and a molecular weight of 478.49 g/mol. Its IUPAC name is [(3aR,7R,10Z,11aR)-9-acetyloxy-7-hydroperoxy-10-methyl-3,6-dimethylidene-2-oxo-4,5,7,8,9,11a-hexahydro-3aH-cyclodeca[b]furan-4-yl] (E)-4-acetyloxy-2-methylbut-2-enoate.
| Compound Name | [(3aR,7R,10Z,11aR)-9-acetyloxy-7-hydroperoxy-10-methyl-3,6-dimethylidene-2-oxo-4,5,7,8,9,11a-hexahydro-3aH-cyclodeca[b]furan-4-yl] (E)-4-acetyloxy-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 177431708 |
| Molecular Formula | C24H30O10 |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | [(3aR,7R,10Z,11aR)-9-acetyloxy-7-hydroperoxy-10-methyl-3,6-dimethylidene-2-oxo-4,5,7,8,9,11a-hexahydro-3aH-cyclodeca[b]furan-4-yl] (E)-4-acetyloxy-2-methylbut-2-enoate |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(/C)C(OC(C)=O)C[C@@H](OO)C(=C)CC(OC(=O)/C(C)=C/COC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C24H30O10/c1-12(7-8-30-16(5)25)23(27)32-20-10-14(3)19(34-29)11-18(31-17(6)26)13(2)9-21-22(20)15(4)24(28)33-21/h7,9,18-22,29H,3-4,8,10-11H2,1-2,5-6H3/b12-7+,13-9-/t18?,19-,20?,21-,22-/m1/s1 |
| InChIKey | KBHIGVSGLBVBLM-IFUFOJSHSA-N |
| XLogP | 2.59 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|