C30H52O3 — CID 162852094
17-(5,6-dimethylheptan-2-yl)-3,3-dimethoxy-10,13-dimethyl-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 162852094) has the molecular formula C30H52O3 and a molecular weight of 460.74 g/mol. Its IUPAC name is 17-(5,6-dimethylheptan-2-yl)-3,3-dimethoxy-10,13-dimethyl-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | 17-(5,6-dimethylheptan-2-yl)-3,3-dimethoxy-10,13-dimethyl-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 162852094 |
| Molecular Formula | C30H52O3 |
| Molecular Weight | 460.74 g/mol |
| Exact Mass | 460.39 |
| IUPAC Name | 17-(5,6-dimethylheptan-2-yl)-3,3-dimethoxy-10,13-dimethyl-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | COC1(OC)CCC2(C)C(C1)C(=O)CC1C2CCC2(C)C(C(C)CCC(C)C(C)C)CCC12 |
| InChI | InChI=1S/C30H52O3/c1-19(2)20(3)9-10-21(4)23-11-12-24-22-17-27(31)26-18-30(32-7,33-8)16-15-29(26,6)25(22)13-14-28(23,24)5/h19-26H,9-18H2,1-8H3 |
| InChIKey | DPDFFNTXDWYSGP-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.74 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|