C26H38O5 — CID 162852619
methyl (1'R,2R,4'S,5'R,9'S,10'S,13'R,15'S)-5',9'-dimethyl-15'-[(E)-2-methylbut-2-enoyl]oxyspiro[oxirane-2,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane]-5'-carboxylate (PubChem CID 162852619) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is methyl (1'R,2R,4'S,5'R,9'S,10'S,13'R,15'S)-5',9'-dimethyl-15'-[(E)-2-methylbut-2-enoyl]oxyspiro[oxirane-2,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane]-5'-carboxylate.
| Compound Name | methyl (1'R,2R,4'S,5'R,9'S,10'S,13'R,15'S)-5',9'-dimethyl-15'-[(E)-2-methylbut-2-enoyl]oxyspiro[oxirane-2,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane]-5'-carboxylate |
|---|---|
| PubChem CID | 162852619 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | methyl (1'R,2R,4'S,5'R,9'S,10'S,13'R,15'S)-5',9'-dimethyl-15'-[(E)-2-methylbut-2-enoyl]oxyspiro[oxirane-2,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane]-5'-carboxylate |
| SMILES | C/C=C(\C)C(=O)O[C@H]1[C@@]23CC[C@H]4[C@@](C)(CCC[C@@]4(C)C(=O)OC)[C@@H]2CC[C@H](C3)[C@@]12CO2 |
| InChI | InChI=1S/C26H38O5/c1-6-16(2)20(27)31-21-25-13-10-18-23(3,11-7-12-24(18,4)22(28)29-5)19(25)9-8-17(14-25)26(21)15-30-26/h6,17-19,21H,7-15H2,1-5H3/b16-6+/t17-,18+,19+,21+,23-,24-,25-,26+/m1/s1 |
| InChIKey | CGNRSXHCMQZVBZ-ZROIOQDISA-N |
| XLogP | 4.83 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|