C32H52O4 — CID 162852751
[4,5-dihydroxy-7,7,12,16-tetramethyl-15-(6-methylhept-5-en-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate (PubChem CID 162852751) has the molecular formula C32H52O4 and a molecular weight of 500.76 g/mol. Its IUPAC name is [4,5-dihydroxy-7,7,12,16-tetramethyl-15-(6-methylhept-5-en-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate.
| Compound Name | [4,5-dihydroxy-7,7,12,16-tetramethyl-15-(6-methylhept-5-en-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate |
|---|---|
| PubChem CID | 162852751 |
| Molecular Formula | C32H52O4 |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | [4,5-dihydroxy-7,7,12,16-tetramethyl-15-(6-methylhept-5-en-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate |
| SMILES | CC(=O)OC1C(O)C(O)C23CC24CCC2(C)C(C(C)CCC=C(C)C)CCC2(C)C4CCC3C1(C)C |
| InChI | InChI=1S/C32H52O4/c1-19(2)10-9-11-20(3)22-14-15-30(8)24-13-12-23-28(5,6)27(36-21(4)33)25(34)26(35)32(23)18-31(24,32)17-16-29(22,30)7/h10,20,22-27,34-35H,9,11-18H2,1-8H3 |
| InChIKey | ZXSOZQFDXGTVED-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|