C28H46O3 — CID 10574688
(1S,3R,6S,7S,9S,11S,12S,15R,16R)-12,16-dimethyl-15-[(2R)-6-methylhept-5-en-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-6,7,9-triol (PubChem CID 10574688) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is (1S,3R,6S,7S,9S,11S,12S,15R,16R)-12,16-dimethyl-15-[(2R)-6-methylhept-5-en-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-6,7,9-triol.
| Compound Name | (1S,3R,6S,7S,9S,11S,12S,15R,16R)-12,16-dimethyl-15-[(2R)-6-methylhept-5-en-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-6,7,9-triol |
|---|---|
| PubChem CID | 10574688 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | (1S,3R,6S,7S,9S,11S,12S,15R,16R)-12,16-dimethyl-15-[(2R)-6-methylhept-5-en-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-6,7,9-triol |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1CC[C@@]2(C)[C@@H]3CC(O)C4[C@H](O)[C@@H](O)CC[C@@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C28H46O3/c1-17(2)7-6-8-18(3)19-9-11-26(5)22-15-21(30)23-24(31)20(29)10-12-28(23)16-27(22,28)14-13-25(19,26)4/h7,18-24,29-31H,6,8-16H2,1-5H3/t18-,19-,20+,21?,22+,23?,24-,25-,26+,27+,28-/m1/s1 |
| InChIKey | ZFSTUNAHLIKZQY-HXKOPHESSA-N |
| XLogP | 5.47 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|