C28H48O2 — CID 162866036
(1S,3R,6S,8R,9S,11R,12S,15R,16R)-12,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-6,9-diol (PubChem CID 162866036) has the molecular formula C28H48O2 and a molecular weight of 416.69 g/mol. Its IUPAC name is (1S,3R,6S,8R,9S,11R,12S,15R,16R)-12,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-6,9-diol.
| Compound Name | (1S,3R,6S,8R,9S,11R,12S,15R,16R)-12,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-6,9-diol |
|---|---|
| PubChem CID | 162866036 |
| Molecular Formula | C28H48O2 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.37 |
| IUPAC Name | (1S,3R,6S,8R,9S,11R,12S,15R,16R)-12,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-6,9-diol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@@]2(C)[C@H]3C[C@H](O)[C@@H]4C[C@@H](O)CC[C@@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C28H48O2/c1-18(2)7-6-8-19(3)21-10-11-26(5)24-16-23(30)22-15-20(29)9-12-27(22)17-28(24,27)14-13-25(21,26)4/h18-24,29-30H,6-17H2,1-5H3/t19-,20+,21-,22+,23+,24-,25-,26+,27-,28+/m1/s1 |
| InChIKey | YYVUMXYSCXRWIL-XMNHCXMWSA-N |
| XLogP | 6.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |