C6H12N4O2 — CID 162853254
trans-(1S,2R)-1-amino-2-[(diaminomethylideneamino)methyl]cyclopropane-1-carboxylic acid (PubChem CID 162853254) has the molecular formula C6H12N4O2 and a molecular weight of 172.19 g/mol. Its IUPAC name is trans-(1S,2R)-1-amino-2-[(diaminomethylideneamino)methyl]cyclopropane-1-carboxylic acid.
| Compound Name | trans-(1S,2R)-1-amino-2-[(diaminomethylideneamino)methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 162853254 |
| Molecular Formula | C6H12N4O2 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | trans-(1S,2R)-1-amino-2-[(diaminomethylideneamino)methyl]cyclopropane-1-carboxylic acid |
| SMILES | NC(N)=NC[C@H]1C[C@@]1(N)C(=O)O |
| InChI | InChI=1S/C6H12N4O2/c7-5(8)10-2-3-1-6(3,9)4(11)12/h3H,1-2,9H2,(H,11,12)(H4,7,8,10)/t3-,6+/m1/s1 |
| InChIKey | UKJXPTCZTCDPQL-CVYQJGLWSA-N |
| XLogP | -1.94 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|