C14H20O6 — CID 162854007
[(2S,4R,7S)-7-hydroxy-2-methyl-5,10-dioxooxecan-4-yl] (E)-but-2-enoate (PubChem CID 162854007) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is [(2S,4R,7S)-7-hydroxy-2-methyl-5,10-dioxooxecan-4-yl] (E)-but-2-enoate.
| Compound Name | [(2S,4R,7S)-7-hydroxy-2-methyl-5,10-dioxooxecan-4-yl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 162854007 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | [(2S,4R,7S)-7-hydroxy-2-methyl-5,10-dioxooxecan-4-yl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)O[C@@H]1C[C@H](C)OC(=O)CC[C@H](O)CC1=O |
| InChI | InChI=1S/C14H20O6/c1-3-4-13(17)20-12-7-9(2)19-14(18)6-5-10(15)8-11(12)16/h3-4,9-10,12,15H,5-8H2,1-2H3/b4-3+/t9-,10-,12+/m0/s1 |
| InChIKey | CHNUUPOAYWBFFJ-CEYJQVEWSA-N |
| XLogP | 0.91 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|