C30H26O14 — CID 162856891
[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-7-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 162856891) has the molecular formula C30H26O14 and a molecular weight of 610.52 g/mol. Its IUPAC name is [2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-7-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-7-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162856891 |
| Molecular Formula | C30H26O14 |
| Molecular Weight | 610.52 g/mol |
| Exact Mass | 610.13 |
| IUPAC Name | [2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-7-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)Oc1cc(O)c2c(=O)cc(-c3ccc(O)c(O)c3)oc2c1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C30H26O14/c31-11-22-26(39)27(40)28(41)30(44-22)25-21(42-23(38)6-2-12-1-4-14(32)16(34)7-12)10-19(37)24-18(36)9-20(43-29(24)25)13-3-5-15(33)17(35)8-13/h1-10,22,26-28,30-35,37,39-41H,11H2/t22-,26-,27+,28-,30+/m1/s1 |
| InChIKey | JMVHKICEUAILDQ-ZHTDWIAYSA-N |
| XLogP | 1.12 |
| TPSA | 247.81 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.52 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|