C30H26O15 — CID 122393208
[(2R,3S,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5,8-dihydroxy-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-eneperoxoate (PubChem CID 122393208) has the molecular formula C30H26O15 and a molecular weight of 626.52 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5,8-dihydroxy-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-eneperoxoate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5,8-dihydroxy-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-eneperoxoate |
|---|---|
| PubChem CID | 122393208 |
| Molecular Formula | C30H26O15 |
| Molecular Weight | 626.52 g/mol |
| Exact Mass | 626.13 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5,8-dihydroxy-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-eneperoxoate |
| SMILES | O=C(/C=C/c1ccc(O)cc1)OOC[C@H]1O[C@@H](Oc2cc(O)c3c(=O)cc(-c4ccc(O)c(O)c4)oc3c2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H26O15/c31-15-5-1-13(2-6-15)3-8-23(36)45-41-12-22-25(37)27(39)28(40)30(44-22)43-21-11-19(35)24-18(34)10-20(42-29(24)26(21)38)14-4-7-16(32)17(33)9-14/h1-11,22,25,27-28,30-33,35,37-40H,12H2/b8-3+/t22-,25-,27+,28-,30-/m1/s1 |
| InChIKey | AQGMCLIMPMMEOZ-QTAGRRMMSA-N |
| XLogP | 1.36 |
| TPSA | 246.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.52 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|