C24H16O8 — CID 163057819
[5,8-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl] 3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 163057819) has the molecular formula C24H16O8 and a molecular weight of 432.38 g/mol. Its IUPAC name is [5,8-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl] 3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [5,8-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl] 3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 163057819 |
| Molecular Formula | C24H16O8 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | [5,8-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl] 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(O)cc1)Oc1cc(O)c2c(=O)cc(-c3ccc(O)cc3)oc2c1O |
| InChI | InChI=1S/C24H16O8/c25-15-6-1-13(2-7-15)3-10-21(29)31-20-12-18(28)22-17(27)11-19(32-24(22)23(20)30)14-4-8-16(26)9-5-14/h1-12,25-26,28,30H |
| InChIKey | GLKGRKVISHNRJV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|