C20H17O12S- — CID 162841287
[2-[5,8-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4,5-dihydroxyoxan-3-yl] sulfite (PubChem CID 162841287) has the molecular formula C20H17O12S- and a molecular weight of 481.41 g/mol. Its IUPAC name is [2-[5,8-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4,5-dihydroxyoxan-3-yl] sulfite.
| Compound Name | [2-[5,8-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4,5-dihydroxyoxan-3-yl] sulfite |
|---|---|
| PubChem CID | 162841287 |
| Molecular Formula | C20H17O12S- |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | [2-[5,8-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4,5-dihydroxyoxan-3-yl] sulfite |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2c(O)c(OC3OCC(O)C(O)C3OS(=O)[O-])cc(O)c12 |
| InChI | InChI=1S/C20H18O12S/c21-9-3-1-8(2-4-9)13-5-10(22)15-11(23)6-14(17(26)18(15)30-13)31-20-19(32-33(27)28)16(25)12(24)7-29-20/h1-6,12,16,19-21,23-26H,7H2,(H,27,28)/p-1 |
| InChIKey | VLISWZHUHLNAGP-UHFFFAOYSA-M |
| XLogP | 0.21 |
| TPSA | 199.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|