C33H39NO9 — CID 162857369
methyl 2-[6-acetyloxy-14-(furan-3-yl)-3,7-dihydroxy-2,5,15-trimethyl-12-oxo-10-propan-2-yl-13-oxa-9-azahexacyclo[9.6.2.12,5.03,7.08,18.015,19]icosa-8,10,18-trien-20-yl]acetate (PubChem CID 162857369) has the molecular formula C33H39NO9 and a molecular weight of 593.67 g/mol. Its IUPAC name is methyl 2-[6-acetyloxy-14-(furan-3-yl)-3,7-dihydroxy-2,5,15-trimethyl-12-oxo-10-propan-2-yl-13-oxa-9-azahexacyclo[9.6.2.12,5.03,7.08,18.015,19]icosa-8,10,18-trien-20-yl]acetate.
| Compound Name | methyl 2-[6-acetyloxy-14-(furan-3-yl)-3,7-dihydroxy-2,5,15-trimethyl-12-oxo-10-propan-2-yl-13-oxa-9-azahexacyclo[9.6.2.12,5.03,7.08,18.015,19]icosa-8,10,18-trien-20-yl]acetate |
|---|---|
| PubChem CID | 162857369 |
| Molecular Formula | C33H39NO9 |
| Molecular Weight | 593.67 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | methyl 2-[6-acetyloxy-14-(furan-3-yl)-3,7-dihydroxy-2,5,15-trimethyl-12-oxo-10-propan-2-yl-13-oxa-9-azahexacyclo[9.6.2.12,5.03,7.08,18.015,19]icosa-8,10,18-trien-20-yl]acetate |
| SMILES | COC(=O)CC1C2(C)CC3(O)C(O)(c4nc(C(C)C)c5c6c4C(CCC6(C)C(c4ccoc4)OC5=O)C13C)C2OC(C)=O |
| InChI | InChI=1S/C33H39NO9/c1-15(2)24-22-23-21-18(8-10-29(23,4)26(43-27(22)37)17-9-11-41-13-17)31(6)19(12-20(36)40-7)30(5)14-32(31,38)33(39,25(21)34-24)28(30)42-16(3)35/h9,11,13,15,18-19,26,28,38-39H,8,10,12,14H2,1-7H3 |
| InChIKey | RPCOERUKOLIYNI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 145.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.67 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|