C27H40O12 — CID 162857628
methyl 6-(8-hydroxy-2,6-dimethylocta-2,6-dienoyl)oxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 162857628) has the molecular formula C27H40O12 and a molecular weight of 556.61 g/mol. Its IUPAC name is methyl 6-(8-hydroxy-2,6-dimethylocta-2,6-dienoyl)oxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl 6-(8-hydroxy-2,6-dimethylocta-2,6-dienoyl)oxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 162857628 |
| Molecular Formula | C27H40O12 |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | methyl 6-(8-hydroxy-2,6-dimethylocta-2,6-dienoyl)oxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)C1=COC(OC2OC(CO)C(O)C(O)C2O)C2C1CC(OC(=O)C(C)=CCCC(C)=CCO)C2C |
| InChI | InChI=1S/C27H40O12/c1-13(8-9-28)6-5-7-14(2)24(33)37-18-10-16-17(25(34)35-4)12-36-26(20(16)15(18)3)39-27-23(32)22(31)21(30)19(11-29)38-27/h7-8,12,15-16,18-23,26-32H,5-6,9-11H2,1-4H3 |
| InChIKey | DRLSVXSQDQVYPF-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 181.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|