C43H64O4 — CID 162858249
bis[(1S,4R,9R,10S,13S,16R)-5,5,9-trimethyl-14-methylidene-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] propanedioate (PubChem CID 162858249) has the molecular formula C43H64O4 and a molecular weight of 644.98 g/mol. Its IUPAC name is bis[(1S,4R,9R,10S,13S,16R)-5,5,9-trimethyl-14-methylidene-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] propanedioate.
| Compound Name | bis[(1S,4R,9R,10S,13S,16R)-5,5,9-trimethyl-14-methylidene-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] propanedioate |
|---|---|
| PubChem CID | 162858249 |
| Molecular Formula | C43H64O4 |
| Molecular Weight | 644.98 g/mol |
| Exact Mass | 644.48 |
| IUPAC Name | bis[(1S,4R,9R,10S,13S,16R)-5,5,9-trimethyl-14-methylidene-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] propanedioate |
| SMILES | C=C1C[C@@]23CC[C@@H]4C(C)(C)CCC[C@@]4(C)[C@@H]2CC[C@@H]1[C@H]3OC(=O)CC(=O)O[C@@H]1[C@H]2CC[C@H]3[C@]4(C)CCCC(C)(C)[C@H]4CC[C@@]13CC2=C |
| InChI | InChI=1S/C43H64O4/c1-26-24-42-21-15-30-38(3,4)17-9-19-40(30,7)32(42)13-11-28(26)36(42)46-34(44)23-35(45)47-37-29-12-14-33-41(8)20-10-18-39(5,6)31(41)16-22-43(33,37)25-27(29)2/h28-33,36-37H,1-2,9-25H2,3-8H3/t28-,29-,30+,31+,32-,33-,36+,37+,40+,41+,42-,43-/m0/s1 |
| InChIKey | CVIBVQWDDDIAHW-SBSKZWGHSA-N |
| XLogP | 10.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.98 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|