C28H44O8 — CID 162859571
16-hydroxy-7,9,13-trimethyl-19-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-one (PubChem CID 162859571) has the molecular formula C28H44O8 and a molecular weight of 508.65 g/mol. Its IUPAC name is 16-hydroxy-7,9,13-trimethyl-19-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-one.
| Compound Name | 16-hydroxy-7,9,13-trimethyl-19-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-one |
|---|---|
| PubChem CID | 162859571 |
| Molecular Formula | C28H44O8 |
| Molecular Weight | 508.65 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 16-hydroxy-7,9,13-trimethyl-19-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-one |
| SMILES | CC1OC(OC2CC3C(CCC4(C)C3CC3OC(=O)C(C)C34)C3(C)CCC(O)CC23)C(O)C(O)C1O |
| InChI | InChI=1S/C28H44O8/c1-12-21-20(35-25(12)33)11-17-15-10-19(36-26-24(32)23(31)22(30)13(2)34-26)18-9-14(29)5-7-27(18,3)16(15)6-8-28(17,21)4/h12-24,26,29-32H,5-11H2,1-4H3 |
| InChIKey | OVTPUSXJHIOUBO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.65 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|