C34H40O10 — CID 162864092
[5-acetyloxy-3-(furan-3-yl)-7-[[3-(2-methoxy-2-oxoethyl)-2,2,4-trimethyl-7-oxo-3H-oxepin-6-ylidene]methyl]-3a-methyl-2,3,4,5-tetrahydro-1aH-indeno[1,7a-b]oxiren-4-yl] 2-methylbut-2-enoate (PubChem CID 162864092) has the molecular formula C34H40O10 and a molecular weight of 608.68 g/mol. Its IUPAC name is [5-acetyloxy-3-(furan-3-yl)-7-[[3-(2-methoxy-2-oxoethyl)-2,2,4-trimethyl-7-oxo-3H-oxepin-6-ylidene]methyl]-3a-methyl-2,3,4,5-tetrahydro-1aH-indeno[1,7a-b]oxiren-4-yl] 2-methylbut-2-enoate.
| Compound Name | [5-acetyloxy-3-(furan-3-yl)-7-[[3-(2-methoxy-2-oxoethyl)-2,2,4-trimethyl-7-oxo-3H-oxepin-6-ylidene]methyl]-3a-methyl-2,3,4,5-tetrahydro-1aH-indeno[1,7a-b]oxiren-4-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162864092 |
| Molecular Formula | C34H40O10 |
| Molecular Weight | 608.68 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | [5-acetyloxy-3-(furan-3-yl)-7-[[3-(2-methoxy-2-oxoethyl)-2,2,4-trimethyl-7-oxo-3H-oxepin-6-ylidene]methyl]-3a-methyl-2,3,4,5-tetrahydro-1aH-indeno[1,7a-b]oxiren-4-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C(OC(C)=O)C=C(C=C2C=C(C)C(CC(=O)OC)C(C)(C)OC2=O)C23OC2CC(c2ccoc2)C13C |
| InChI | InChI=1S/C34H40O10/c1-9-18(2)30(37)42-29-26(41-20(4)35)14-23(34-27(43-34)15-25(33(29,34)7)21-10-11-40-17-21)13-22-12-19(3)24(16-28(36)39-8)32(5,6)44-31(22)38/h9-14,17,24-27,29H,15-16H2,1-8H3 |
| InChIKey | OVVVEOZMTNSRTB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 130.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.68 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|