C34H40O9 — CID 162917352
[5-acetyloxy-3-(furan-3-yl)-7-[[3-(2-methoxy-2-oxoethyl)-2,2,4-trimethyl-7-oxo-3H-oxepin-6-ylidene]methyl]-3a-methyl-2,3,4,5-tetrahydroinden-4-yl] 2-methylbut-2-enoate (PubChem CID 162917352) has the molecular formula C34H40O9 and a molecular weight of 592.69 g/mol. Its IUPAC name is [5-acetyloxy-3-(furan-3-yl)-7-[[3-(2-methoxy-2-oxoethyl)-2,2,4-trimethyl-7-oxo-3H-oxepin-6-ylidene]methyl]-3a-methyl-2,3,4,5-tetrahydroinden-4-yl] 2-methylbut-2-enoate.
| Compound Name | [5-acetyloxy-3-(furan-3-yl)-7-[[3-(2-methoxy-2-oxoethyl)-2,2,4-trimethyl-7-oxo-3H-oxepin-6-ylidene]methyl]-3a-methyl-2,3,4,5-tetrahydroinden-4-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162917352 |
| Molecular Formula | C34H40O9 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.27 |
| IUPAC Name | [5-acetyloxy-3-(furan-3-yl)-7-[[3-(2-methoxy-2-oxoethyl)-2,2,4-trimethyl-7-oxo-3H-oxepin-6-ylidene]methyl]-3a-methyl-2,3,4,5-tetrahydroinden-4-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C(OC(C)=O)C=C(C=C2C=C(C)C(CC(=O)OC)C(C)(C)OC2=O)C2=CCC(c3ccoc3)C21C |
| InChI | InChI=1S/C34H40O9/c1-9-19(2)31(37)42-30-28(41-21(4)35)16-23(26-11-10-25(34(26,30)7)22-12-13-40-18-22)15-24-14-20(3)27(17-29(36)39-8)33(5,6)43-32(24)38/h9,11-16,18,25,27-28,30H,10,17H2,1-8H3 |
| InChIKey | VXLKXBLTTPCBMV-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 118.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|