C27H30O9 — CID 162864634
[(1R,2S,4S,6R,8R,9R,10R,11S,13R,17S,22R)-8-(furan-3-yl)-1,9,17-trimethyl-3-methylidene-15,20-dioxo-5,12,16,19-tetraoxahexacyclo[11.9.0.02,11.04,6.04,9.017,22]docosan-10-yl] formate (PubChem CID 162864634) has the molecular formula C27H30O9 and a molecular weight of 498.53 g/mol. Its IUPAC name is [(1R,2S,4S,6R,8R,9R,10R,11S,13R,17S,22R)-8-(furan-3-yl)-1,9,17-trimethyl-3-methylidene-15,20-dioxo-5,12,16,19-tetraoxahexacyclo[11.9.0.02,11.04,6.04,9.017,22]docosan-10-yl] formate.
| Compound Name | [(1R,2S,4S,6R,8R,9R,10R,11S,13R,17S,22R)-8-(furan-3-yl)-1,9,17-trimethyl-3-methylidene-15,20-dioxo-5,12,16,19-tetraoxahexacyclo[11.9.0.02,11.04,6.04,9.017,22]docosan-10-yl] formate |
|---|---|
| PubChem CID | 162864634 |
| Molecular Formula | C27H30O9 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | [(1R,2S,4S,6R,8R,9R,10R,11S,13R,17S,22R)-8-(furan-3-yl)-1,9,17-trimethyl-3-methylidene-15,20-dioxo-5,12,16,19-tetraoxahexacyclo[11.9.0.02,11.04,6.04,9.017,22]docosan-10-yl] formate |
| SMILES | C=C1[C@H]2[C@H](O[C@@H]3CC(=O)O[C@]4(C)COC(=O)C[C@@H]4[C@]32C)[C@H](OC=O)[C@@]2(C)[C@@H](c3ccoc3)C[C@H]3O[C@]132 |
| InChI | InChI=1S/C27H30O9/c1-13-21-22(34-17-9-20(30)36-24(2)11-32-19(29)8-16(24)25(17,21)3)23(33-12-28)26(4)15(14-5-6-31-10-14)7-18-27(13,26)35-18/h5-6,10,12,15-18,21-23H,1,7-9,11H2,2-4H3/t15-,16+,17-,18-,21+,22+,23+,24-,25-,26-,27-/m1/s1 |
| InChIKey | TURHVLPKQIWXPP-WXZRIWNCSA-N |
| XLogP | 2.68 |
| TPSA | 113.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|