C15H20O5 — CID 162865831
(1aS,6R,7R,7aR,7bR)-6-hydroxy-1a-[(2S)-2-(hydroxymethyl)oxiran-2-yl]-7,7a-dimethyl-5,6,7,7b-tetrahydro-4H-naphtho[1,2-b]oxiren-2-one (PubChem CID 162865831) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (1aS,6R,7R,7aR,7bR)-6-hydroxy-1a-[(2S)-2-(hydroxymethyl)oxiran-2-yl]-7,7a-dimethyl-5,6,7,7b-tetrahydro-4H-naphtho[1,2-b]oxiren-2-one.
| Compound Name | (1aS,6R,7R,7aR,7bR)-6-hydroxy-1a-[(2S)-2-(hydroxymethyl)oxiran-2-yl]-7,7a-dimethyl-5,6,7,7b-tetrahydro-4H-naphtho[1,2-b]oxiren-2-one |
|---|---|
| PubChem CID | 162865831 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (1aS,6R,7R,7aR,7bR)-6-hydroxy-1a-[(2S)-2-(hydroxymethyl)oxiran-2-yl]-7,7a-dimethyl-5,6,7,7b-tetrahydro-4H-naphtho[1,2-b]oxiren-2-one |
| SMILES | C[C@H]1[C@H](O)CCC2=CC(=O)[C@]3([C@]4(CO)CO4)O[C@@H]3[C@@]21C |
| InChI | InChI=1S/C15H20O5/c1-8-10(17)4-3-9-5-11(18)15(14(6-16)7-19-14)12(20-15)13(8,9)2/h5,8,10,12,16-17H,3-4,6-7H2,1-2H3/t8-,10+,12+,13+,14-,15-/m0/s1 |
| InChIKey | DDKJQSAECJSUNP-YFBXYODDSA-N |
| XLogP | 0.19 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|