C16H26 — CID 162865986
(1S,2R,4S,9S,12S)-3,3,12-trimethyl-8-methylidenetricyclo[7.3.0.02,4]dodecane (PubChem CID 162865986) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is (1S,2R,4S,9S,12S)-3,3,12-trimethyl-8-methylidenetricyclo[7.3.0.02,4]dodecane.
| Compound Name | (1S,2R,4S,9S,12S)-3,3,12-trimethyl-8-methylidenetricyclo[7.3.0.02,4]dodecane |
|---|---|
| PubChem CID | 162865986 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | (1S,2R,4S,9S,12S)-3,3,12-trimethyl-8-methylidenetricyclo[7.3.0.02,4]dodecane |
| SMILES | C=C1CCC[C@H]2[C@@H]([C@@H]3[C@@H]1CC[C@@H]3C)C2(C)C |
| InChI | InChI=1S/C16H26/c1-10-6-5-7-13-15(16(13,3)4)14-11(2)8-9-12(10)14/h11-15H,1,5-9H2,2-4H3/t11-,12+,13-,14-,15-/m0/s1 |
| InChIKey | QQQOPBVPEDBXOA-AICCOOGYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|