C20H26O3 — CID 139292016
(1S,4S,5S,8S,9R,10R,12S)-5-hydroxy-4,8,11,11-tetramethyl-15-methylidenetetracyclo[7.6.0.02,6.010,12]pentadec-2(6)-ene-3,7-dione (PubChem CID 139292016) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (1S,4S,5S,8S,9R,10R,12S)-5-hydroxy-4,8,11,11-tetramethyl-15-methylidenetetracyclo[7.6.0.02,6.010,12]pentadec-2(6)-ene-3,7-dione.
| Compound Name | (1S,4S,5S,8S,9R,10R,12S)-5-hydroxy-4,8,11,11-tetramethyl-15-methylidenetetracyclo[7.6.0.02,6.010,12]pentadec-2(6)-ene-3,7-dione |
|---|---|
| PubChem CID | 139292016 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (1S,4S,5S,8S,9R,10R,12S)-5-hydroxy-4,8,11,11-tetramethyl-15-methylidenetetracyclo[7.6.0.02,6.010,12]pentadec-2(6)-ene-3,7-dione |
| SMILES | C=C1CC[C@H]2[C@@H]([C@@H]3[C@@H]1C1=C(C(=O)[C@H]3C)[C@@H](O)[C@H](C)C1=O)C2(C)C |
| InChI | InChI=1S/C20H26O3/c1-8-6-7-11-16(20(11,4)5)13-9(2)17(21)15-14(12(8)13)18(22)10(3)19(15)23/h9-13,16,19,23H,1,6-7H2,2-5H3/t9-,10+,11-,12+,13-,16-,19-/m0/s1 |
| InChIKey | POSJOOWBIBDQRR-NPUSIUFYSA-N |
| XLogP | 2.94 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|